C15H18N2O4 — CID 57247164
2-(1H-pyrrol-2-yl)-N-(2,4,6-trimethoxyphenyl)acetamide (PubChem CID 57247164) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(1H-pyrrol-2-yl)-N-(2,4,6-trimethoxyphenyl)acetamide.
| Compound Name | 2-(1H-pyrrol-2-yl)-N-(2,4,6-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 57247164 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(1H-pyrrol-2-yl)-N-(2,4,6-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)Cc2ccc[nH]2)c(OC)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-19-11-8-12(20-2)15(13(9-11)21-3)17-14(18)7-10-5-4-6-16-10/h4-6,8-9,16H,7H2,1-3H3,(H,17,18) |
| InChIKey | MSDNYESCUAJBJJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |