C14H16N2O — CID 110690882
N-(2,4-dimethylphenyl)-2-(1H-pyrrol-2-yl)acetamide (PubChem CID 110690882) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(1H-pyrrol-2-yl)acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(1H-pyrrol-2-yl)acetamide |
|---|---|
| PubChem CID | 110690882 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(1H-pyrrol-2-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccc[nH]2)c(C)c1 |
| InChI | InChI=1S/C14H16N2O/c1-10-5-6-13(11(2)8-10)16-14(17)9-12-4-3-7-15-12/h3-8,15H,9H2,1-2H3,(H,16,17) |
| InChIKey | ONGXUPXGJHFQRT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |