C19H20N2O4 — CID 86748282
3-cyano-3-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide (PubChem CID 86748282) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-cyano-3-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide.
| Compound Name | 3-cyano-3-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 86748282 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-cyano-3-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(OC)c(NC(=O)CC(C#N)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-23-15-10-16(24-2)19(17(11-15)25-3)21-18(22)9-14(12-20)13-7-5-4-6-8-13/h4-8,10-11,14H,9H2,1-3H3,(H,21,22) |
| InChIKey | DYCZWTSRIUUWFI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |