C11H10NO3- — CID 7350517
(3S)-3-cyano-3-(4-methoxyphenyl)propanoate (PubChem CID 7350517) has the molecular formula C11H10NO3- and a molecular weight of 204.20 g/mol. Its IUPAC name is (3S)-3-cyano-3-(4-methoxyphenyl)propanoate.
| Compound Name | (3S)-3-cyano-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7350517 |
| Molecular Formula | C11H10NO3- |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (3S)-3-cyano-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc([C@@H](C#N)CC(=O)[O-])cc1 |
| InChI | InChI=1S/C11H11NO3/c1-15-10-4-2-8(3-5-10)9(7-12)6-11(13)14/h2-5,9H,6H2,1H3,(H,13,14)/p-1/t9-/m1/s1 |
| InChIKey | FZDMDZGSRLDCCR-SECBINFHSA-M |
| XLogP | 0.44 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |