C13H17O3- — CID 7083022
(3S)-3-(4-methoxyphenyl)-4-methylpentanoate (PubChem CID 7083022) has the molecular formula C13H17O3- and a molecular weight of 221.28 g/mol. Its IUPAC name is (3S)-3-(4-methoxyphenyl)-4-methylpentanoate.
| Compound Name | (3S)-3-(4-methoxyphenyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 7083022 |
| Molecular Formula | C13H17O3- |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3S)-3-(4-methoxyphenyl)-4-methylpentanoate |
| SMILES | COc1ccc([C@@H](CC(=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C13H18O3/c1-9(2)12(8-13(14)15)10-4-6-11(16-3)7-5-10/h4-7,9,12H,8H2,1-3H3,(H,14,15)/p-1/t12-/m0/s1 |
| InChIKey | IJYNCBAHVKZWIQ-LBPRGKRZSA-M |
| XLogP | 1.57 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |