C26H23N2NaO5 — CID 56640355
sodium 3-cyano-3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 56640355) has the molecular formula C26H23N2NaO5 and a molecular weight of 466.47 g/mol. Its IUPAC name is sodium 3-cyano-3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | sodium 3-cyano-3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 56640355 |
| Molecular Formula | C26H23N2NaO5 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | sodium 3-cyano-3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | CO/N=C(/COc1ccc(COc2ccc(C(C#N)CC(=O)[O-])cc2)cc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C26H24N2O5.Na/c1-31-28-25(21-5-3-2-4-6-21)18-33-23-11-7-19(8-12-23)17-32-24-13-9-20(10-14-24)22(16-27)15-26(29)30;/h2-14,22H,15,17-18H2,1H3,(H,29,30);/q;+1/p-1/b28-25-; |
| InChIKey | ZRSRGPQLANNCTJ-WLNXZIBISA-M |
| XLogP | 0.45 |
| TPSA | 103.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|