C26H22FN2NaO5 — CID 56640351
sodium 3-cyano-3-[4-[[3-fluoro-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 56640351) has the molecular formula C26H22FN2NaO5 and a molecular weight of 484.46 g/mol. Its IUPAC name is sodium 3-cyano-3-[4-[[3-fluoro-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | sodium 3-cyano-3-[4-[[3-fluoro-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 56640351 |
| Molecular Formula | C26H22FN2NaO5 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | sodium 3-cyano-3-[4-[[3-fluoro-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(C(C#N)CC(=O)[O-])cc2)cc1F)c1ccccc1.[Na+] |
| InChI | InChI=1S/C26H23FN2O5.Na/c1-32-29-24(20-5-3-2-4-6-20)17-34-25-12-7-18(13-23(25)27)16-33-22-10-8-19(9-11-22)21(15-28)14-26(30)31;/h2-13,21H,14,16-17H2,1H3,(H,30,31);/q;+1/p-1/b29-24+; |
| InChIKey | DYDYDLSAEYGISP-DHRMVMEWSA-M |
| XLogP | 0.59 |
| TPSA | 103.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|