C27H25FN2O5 — CID 123349543
methyl 3-cyano-3-[4-[[3-fluoro-4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate (PubChem CID 123349543) has the molecular formula C27H25FN2O5 and a molecular weight of 476.50 g/mol. Its IUPAC name is methyl 3-cyano-3-[4-[[3-fluoro-4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-cyano-3-[4-[[3-fluoro-4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 123349543 |
| Molecular Formula | C27H25FN2O5 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | methyl 3-cyano-3-[4-[[3-fluoro-4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate |
| SMILES | CON=C(COc1ccc(COc2ccc(C(C#N)CC(=O)OC)cc2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C27H25FN2O5/c1-32-27(31)15-22(16-29)20-9-11-23(12-10-20)34-17-19-8-13-26(24(28)14-19)35-18-25(30-33-2)21-6-4-3-5-7-21/h3-14,22H,15,17-18H2,1-2H3 |
| InChIKey | DOLYDNWXHVSMNP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|