C27H30N2O5 — CID 88581371
methyl 3-cyano-3-[4-[[4-[(Z,2Z,3E)-3-ethylidene-2-methoxyiminohex-4-enoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 88581371) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl 3-cyano-3-[4-[[4-[(Z,2Z,3E)-3-ethylidene-2-methoxyiminohex-4-enoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-cyano-3-[4-[[4-[(Z,2Z,3E)-3-ethylidene-2-methoxyiminohex-4-enoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 88581371 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | methyl 3-cyano-3-[4-[[4-[(Z,2Z,3E)-3-ethylidene-2-methoxyiminohex-4-enoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | C/C=C\C(=C/C)\C(COc1ccc(COc2ccc(C(C#N)CC(=O)OC)cc2)cc1)=N\OC |
| InChI | InChI=1S/C27H30N2O5/c1-5-7-21(6-2)26(29-32-4)19-34-24-12-8-20(9-13-24)18-33-25-14-10-22(11-15-25)23(17-28)16-27(30)31-3/h5-15,23H,16,18-19H2,1-4H3/b7-5-,21-6+,29-26+ |
| InChIKey | DJFQDAVNVNAKTF-FHNFXMEGSA-N |
| XLogP | 5.34 |
| TPSA | 90.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|