C30H33NO5 — CID 123706931
methyl 3-cyclopropyl-3-[4-[[4-[2-methoxyimino-2-(3-methylphenyl)ethoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 123706931) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is methyl 3-cyclopropyl-3-[4-[[4-[2-methoxyimino-2-(3-methylphenyl)ethoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-cyclopropyl-3-[4-[[4-[2-methoxyimino-2-(3-methylphenyl)ethoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 123706931 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | methyl 3-cyclopropyl-3-[4-[[4-[2-methoxyimino-2-(3-methylphenyl)ethoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | CON=C(COc1ccc(COc2ccc(C(CC(=O)OC)C3CC3)cc2)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C30H33NO5/c1-21-5-4-6-25(17-21)29(31-34-3)20-36-26-13-7-22(8-14-26)19-35-27-15-11-24(12-16-27)28(23-9-10-23)18-30(32)33-2/h4-8,11-17,23,28H,9-10,18-20H2,1-3H3 |
| InChIKey | SMPKXMUZGOHIFR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|