C26H27NO5 — CID 86695725
methyl 3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 86695725) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is methyl 3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 86695725 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | methyl 3-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | CO/N=C(/COc1ccc(COc2ccc(CCC(=O)OC)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO5/c1-29-26(28)17-12-20-8-13-23(14-9-20)31-18-21-10-15-24(16-11-21)32-19-25(27-30-2)22-6-4-3-5-7-22/h3-11,13-16H,12,17-19H2,1-2H3/b27-25- |
| InChIKey | ROUWOHOOPXAATD-RFBIWTDZSA-N |
| XLogP | 4.80 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|