C27H29NO6 — CID 123239320
ethyl 3-[2-hydroxy-4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate (PubChem CID 123239320) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is ethyl 3-[2-hydroxy-4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[2-hydroxy-4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 123239320 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | ethyl 3-[2-hydroxy-4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCc2ccc(OCC(=NOC)c3ccccc3)cc2)cc1O |
| InChI | InChI=1S/C27H29NO6/c1-3-32-27(30)16-12-22-11-15-24(17-26(22)29)33-18-20-9-13-23(14-10-20)34-19-25(28-31-2)21-7-5-4-6-8-21/h4-11,13-15,17,29H,3,12,16,18-19H2,1-2H3 |
| InChIKey | NHXAQPOKEFCGBQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|