C27H27NO5 — CID 123759809
ethyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]prop-2-enoate (PubChem CID 123759809) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is ethyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123759809 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | ethyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(OCc2ccc(OCC(=NOC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H27NO5/c1-3-31-27(29)18-13-21-9-14-24(15-10-21)32-19-22-11-16-25(17-12-22)33-20-26(28-30-2)23-7-5-4-6-8-23/h4-18H,3,19-20H2,1-2H3 |
| InChIKey | HCHZJLDSEFDKBL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|