C27H24N2O6 — CID 56640140
4-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylic acid (PubChem CID 56640140) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is 4-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylic acid.
| Compound Name | 4-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 56640140 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-[4-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylic acid |
| SMILES | CO/N=C(/COc1ccc(COc2ccc(-c3c(C(=O)O)noc3C)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O6/c1-18-25(26(27(30)31)29-35-18)21-10-14-23(15-11-21)33-16-19-8-12-22(13-9-19)34-17-24(28-32-2)20-6-4-3-5-7-20/h3-15H,16-17H2,1-2H3,(H,30,31)/b28-24- |
| InChIKey | UIMDGGBQKZHGSK-COOPMVRXSA-N |
| XLogP | 5.36 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|