C28H26N2O6 — CID 123154378
methyl 4-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 123154378) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is methyl 4-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 4-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 123154378 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | methyl 4-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-5-methyl-1,2-oxazole-3-carboxylate |
| SMILES | CONC(=COc1ccc(COc2ccc(-c3c(C(=O)OC)noc3C)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O6/c1-19-26(27(30-36-19)28(31)32-2)22-11-15-24(16-12-22)34-17-20-9-13-23(14-10-20)35-18-25(29-33-3)21-7-5-4-6-8-21/h4-16,18,29H,17H2,1-3H3 |
| InChIKey | WOQLQOQELFSKMP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|