C26H26FNO6 — CID 123472115
3-[2-fluoro-4-[[3-methoxy-4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 123472115) has the molecular formula C26H26FNO6 and a molecular weight of 467.49 g/mol. Its IUPAC name is 3-[2-fluoro-4-[[3-methoxy-4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-4-[[3-methoxy-4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123472115 |
| Molecular Formula | C26H26FNO6 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 3-[2-fluoro-4-[[3-methoxy-4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CONC(=COc1ccc(COc2ccc(CCC(=O)O)c(F)c2)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C26H26FNO6/c1-31-25-14-18(16-33-21-11-9-19(22(27)15-21)10-13-26(29)30)8-12-24(25)34-17-23(28-32-2)20-6-4-3-5-7-20/h3-9,11-12,14-15,17,28H,10,13,16H2,1-2H3,(H,29,30) |
| InChIKey | VDGLGMLRUSVRPP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|