C26H27FN2O6 — CID 172961080
amino 3-[2-fluoro-4-[[3-methoxy-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 172961080) has the molecular formula C26H27FN2O6 and a molecular weight of 482.51 g/mol. Its IUPAC name is amino 3-[2-fluoro-4-[[3-methoxy-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | amino 3-[2-fluoro-4-[[3-methoxy-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 172961080 |
| Molecular Formula | C26H27FN2O6 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | amino 3-[2-fluoro-4-[[3-methoxy-4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(CCC(=O)ON)c(F)c2)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C26H27FN2O6/c1-31-25-14-18(16-33-21-11-9-19(22(27)15-21)10-13-26(30)35-28)8-12-24(25)34-17-23(29-32-2)20-6-4-3-5-7-20/h3-9,11-12,14-15H,10,13,16-17,28H2,1-2H3/b29-23+ |
| InChIKey | KNGBQRFCSMQBDW-BYNJWEBRSA-N |
| XLogP | 4.19 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|