C27H26N2O6 — CID 56640643
3-[2-(cyanomethoxy)-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 56640643) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is 3-[2-(cyanomethoxy)-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-(cyanomethoxy)-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 56640643 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 3-[2-(cyanomethoxy)-4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(CCC(=O)O)c(OCC#N)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O6/c1-32-29-25(21-5-3-2-4-6-21)19-35-23-11-7-20(8-12-23)18-34-24-13-9-22(10-14-27(30)31)26(17-24)33-16-15-28/h2-9,11-13,17H,10,14,16,18-19H2,1H3,(H,30,31)/b29-25+ |
| InChIKey | OQICDRCZWNJHHH-XLVZBRSZSA-N |
| XLogP | 4.61 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|