C26H27NO5 — CID 88581379
3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]butanoic acid (PubChem CID 88581379) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]butanoic acid.
| Compound Name | 3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 88581379 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]butanoic acid |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(C(C)CC(=O)O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO5/c1-19(16-26(28)29)21-10-14-24(15-11-21)31-17-20-8-12-23(13-9-20)32-18-25(27-30-2)22-6-4-3-5-7-22/h3-15,19H,16-18H2,1-2H3,(H,28,29)/b27-25+ |
| InChIKey | JLSRCXCYAPHIGR-IMVLJIQESA-N |
| XLogP | 5.27 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|