C29H31NO5 — CID 123869827
methyl 3-cyclopropyl-3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate (PubChem CID 123869827) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is methyl 3-cyclopropyl-3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-cyclopropyl-3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 123869827 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | methyl 3-cyclopropyl-3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]propanoate |
| SMILES | CON=C(COc1ccc(COc2ccc(C(CC(=O)OC)C3CC3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H31NO5/c1-32-29(31)18-27(22-10-11-22)23-12-16-26(17-13-23)34-19-21-8-14-25(15-9-21)35-20-28(30-33-2)24-6-4-3-5-7-24/h3-9,12-17,22,27H,10-11,18-20H2,1-2H3 |
| InChIKey | BISXOVDZKDHCJG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|