C32H32N2O5 — CID 88582976
benzyl 3-amino-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 88582976) has the molecular formula C32H32N2O5 and a molecular weight of 524.62 g/mol. Its IUPAC name is benzyl 3-amino-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | benzyl 3-amino-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 88582976 |
| Molecular Formula | C32H32N2O5 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | benzyl 3-amino-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(C(N)CC(=O)OCc3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O5/c1-36-34-31(27-10-6-3-7-11-27)23-38-28-16-12-25(13-17-28)21-37-29-18-14-26(15-19-29)30(33)20-32(35)39-22-24-8-4-2-5-9-24/h2-19,30H,20-23,33H2,1H3/b34-31+ |
| InChIKey | ITKDKOODECWMGE-WUVHBKSUSA-N |
| XLogP | 5.83 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|