C31H29NO5 — CID 56639772
3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-phenylpropanoic acid (PubChem CID 56639772) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-phenylpropanoic acid.
| Compound Name | 3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 56639772 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-phenylpropanoic acid |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(C(CC(=O)O)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H29NO5/c1-35-32-30(26-10-6-3-7-11-26)22-37-27-16-12-23(13-17-27)21-36-28-18-14-25(15-19-28)29(20-31(33)34)24-8-4-2-5-9-24/h2-19,29H,20-22H2,1H3,(H,33,34)/b32-30+ |
| InChIKey | RKAYQZATAAXLSZ-NHQGMKOOSA-N |
| XLogP | 6.30 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|