C26H23FN2O5 — CID 56640072
3-cyano-3-[4-[[4-[(2Z)-2-(4-fluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 56640072) has the molecular formula C26H23FN2O5 and a molecular weight of 462.48 g/mol. Its IUPAC name is 3-cyano-3-[4-[[4-[(2Z)-2-(4-fluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-cyano-3-[4-[[4-[(2Z)-2-(4-fluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 56640072 |
| Molecular Formula | C26H23FN2O5 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-cyano-3-[4-[[4-[(2Z)-2-(4-fluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(C(C#N)CC(=O)O)cc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H23FN2O5/c1-32-29-25(20-4-8-22(27)9-5-20)17-34-23-10-2-18(3-11-23)16-33-24-12-6-19(7-13-24)21(15-28)14-26(30)31/h2-13,21H,14,16-17H2,1H3,(H,30,31)/b29-25+ |
| InChIKey | PBKDWKDNKUINHQ-XLVZBRSZSA-N |
| XLogP | 4.92 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|