C27H25NO8 — CID 87106347
methyl 5-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 87106347) has the molecular formula C27H25NO8 and a molecular weight of 491.50 g/mol. Its IUPAC name is methyl 5-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl 5-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 87106347 |
| Molecular Formula | C27H25NO8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | methyl 5-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | CO/N=C(\COc1ccc(COc2ccc(C3OC(=O)OC3C(=O)OC)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO8/c1-31-26(29)25-24(35-27(30)36-25)20-10-14-22(15-11-20)33-16-18-8-12-21(13-9-18)34-17-23(28-32-2)19-6-4-3-5-7-19/h3-15,24-25H,16-17H2,1-2H3/b28-23+ |
| InChIKey | UORNOCXDKKIAQZ-WEMUOSSPSA-N |
| XLogP | 4.44 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|