C30H30N2O6 — CID 88581465
(3Z)-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-[(3E)-penta-1,3-dien-3-yl]oxyiminopropanoic acid (PubChem CID 88581465) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is (3Z)-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-[(3E)-penta-1,3-dien-3-yl]oxyiminopropanoic acid.
| Compound Name | (3Z)-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-[(3E)-penta-1,3-dien-3-yl]oxyiminopropanoic acid |
|---|---|
| PubChem CID | 88581465 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (3Z)-3-[4-[[4-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]-3-[(3E)-penta-1,3-dien-3-yl]oxyiminopropanoic acid |
| SMILES | C=C/C(=C\C)O/N=C(/CC(=O)O)c1ccc(OCc2ccc(OC/C(=N\OC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O6/c1-4-25(5-2)38-32-28(19-30(33)34)24-13-17-27(18-14-24)36-20-22-11-15-26(16-12-22)37-21-29(31-35-3)23-9-7-6-8-10-23/h4-18H,1,19-21H2,2-3H3,(H,33,34)/b25-5+,31-29+,32-28- |
| InChIKey | CSHAAXBTQPWCQX-HSPLXFFMSA-N |
| XLogP | 5.98 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|