C30H31NO6 — CID 123219033
methyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]-4-prop-2-enoxybut-3-enoate (PubChem CID 123219033) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is methyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]-4-prop-2-enoxybut-3-enoate.
| Compound Name | methyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]-4-prop-2-enoxybut-3-enoate |
|---|---|
| PubChem CID | 123219033 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | methyl 3-[4-[[4-(2-methoxyimino-2-phenylethoxy)phenyl]methoxy]phenyl]-4-prop-2-enoxybut-3-enoate |
| SMILES | C=CCOC=C(CC(=O)OC)c1ccc(OCc2ccc(OCC(=NOC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H31NO6/c1-4-18-35-21-26(19-30(32)33-2)24-12-16-28(17-13-24)36-20-23-10-14-27(15-11-23)37-22-29(31-34-3)25-8-6-5-7-9-25/h4-17,21H,1,18-20,22H2,2-3H3 |
| InChIKey | ZQVXUVDXERAUTC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|