C26H24N2O5 — CID 56639925
2-cyano-3-[4-[[3-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 56639925) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-cyano-3-[4-[[3-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 2-cyano-3-[4-[[3-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 56639925 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-cyano-3-[4-[[3-[(2Z)-2-methoxyimino-2-phenylethoxy]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CO/N=C(\COc1cccc(COc2ccc(CC(C#N)C(=O)O)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H24N2O5/c1-31-28-25(21-7-3-2-4-8-21)18-33-24-9-5-6-20(15-24)17-32-23-12-10-19(11-13-23)14-22(16-27)26(29)30/h2-13,15,22H,14,17-18H2,1H3,(H,29,30)/b28-25+ |
| InChIKey | XFMUKBBCIVSLLF-AZPGRJICSA-N |
| XLogP | 4.46 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|