C18H17NO4 — CID 66685231
methyl 2-cyano-3-[4-[(3-hydroxyphenyl)methoxy]phenyl]propanoate (PubChem CID 66685231) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 2-cyano-3-[4-[(3-hydroxyphenyl)methoxy]phenyl]propanoate.
| Compound Name | methyl 2-cyano-3-[4-[(3-hydroxyphenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 66685231 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 2-cyano-3-[4-[(3-hydroxyphenyl)methoxy]phenyl]propanoate |
| SMILES | COC(=O)C(C#N)Cc1ccc(OCc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C18H17NO4/c1-22-18(21)15(11-19)9-13-5-7-17(8-6-13)23-12-14-3-2-4-16(20)10-14/h2-8,10,15,20H,9,12H2,1H3 |
| InChIKey | QIPWRCMMJVINNW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |