C14H20O3 — CID 144688794
cyclopropane;methyl 3-(3-hydroxyphenyl)-2-methylpropanoate (PubChem CID 144688794) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is cyclopropane;methyl 3-(3-hydroxyphenyl)-2-methylpropanoate.
| Compound Name | cyclopropane;methyl 3-(3-hydroxyphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 144688794 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | cyclopropane;methyl 3-(3-hydroxyphenyl)-2-methylpropanoate |
| SMILES | C1CC1.COC(=O)C(C)Cc1cccc(O)c1 |
| InChI | InChI=1S/C11H14O3.C3H6/c1-8(11(13)14-2)6-9-4-3-5-10(12)7-9;1-2-3-1/h3-5,7-8,12H,6H2,1-2H3;1-3H2 |
| InChIKey | KRPGNWGJBXXIRC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |