C19H29NO3 — CID 144899407
cyclopropane;methyl 3-[3-[1-(azetidin-3-yl)ethoxy]phenyl]-2-methylpropanoate (PubChem CID 144899407) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is cyclopropane;methyl 3-[3-[1-(azetidin-3-yl)ethoxy]phenyl]-2-methylpropanoate.
| Compound Name | cyclopropane;methyl 3-[3-[1-(azetidin-3-yl)ethoxy]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 144899407 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | cyclopropane;methyl 3-[3-[1-(azetidin-3-yl)ethoxy]phenyl]-2-methylpropanoate |
| SMILES | C1CC1.COC(=O)C(C)Cc1cccc(OC(C)C2CNC2)c1 |
| InChI | InChI=1S/C16H23NO3.C3H6/c1-11(16(18)19-3)7-13-5-4-6-15(8-13)20-12(2)14-9-17-10-14;1-2-3-1/h4-6,8,11-12,14,17H,7,9-10H2,1-3H3;1-3H2 |
| InChIKey | OHZZWNFQIOATSE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |