C26H27NO5 — CID 172922259
(Z)-N-methoxy-2-[2-methoxy-4-[(3-methyl-2,3-dihydro-1-benzofuran-6-yl)oxymethyl]phenoxy]-1-phenylethanimine (PubChem CID 172922259) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is (Z)-N-methoxy-2-[2-methoxy-4-[(3-methyl-2,3-dihydro-1-benzofuran-6-yl)oxymethyl]phenoxy]-1-phenylethanimine.
| Compound Name | (Z)-N-methoxy-2-[2-methoxy-4-[(3-methyl-2,3-dihydro-1-benzofuran-6-yl)oxymethyl]phenoxy]-1-phenylethanimine |
|---|---|
| PubChem CID | 172922259 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (Z)-N-methoxy-2-[2-methoxy-4-[(3-methyl-2,3-dihydro-1-benzofuran-6-yl)oxymethyl]phenoxy]-1-phenylethanimine |
| SMILES | CO/N=C(\COc1ccc(COc2ccc3c(c2)OCC3C)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C26H27NO5/c1-18-15-31-25-14-21(10-11-22(18)25)30-16-19-9-12-24(26(13-19)28-2)32-17-23(27-29-3)20-7-5-4-6-8-20/h4-14,18H,15-17H2,1-3H3/b27-23+ |
| InChIKey | WZZLQYRTQHELMX-SLEBQGDGSA-N |
| XLogP | 5.20 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|