C26H23F2NO6 — CID 141440201
2-[6-[[4-[2-(3,4-difluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 141440201) has the molecular formula C26H23F2NO6 and a molecular weight of 483.47 g/mol. Its IUPAC name is 2-[6-[[4-[2-(3,4-difluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[6-[[4-[2-(3,4-difluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 141440201 |
| Molecular Formula | C26H23F2NO6 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 2-[6-[[4-[2-(3,4-difluorophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | CON=C(COc1ccc(COc2ccc3c(c2)OCC3CC(=O)O)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H23F2NO6/c1-32-29-24(17-4-9-22(27)23(28)10-17)15-34-19-5-2-16(3-6-19)13-33-20-7-8-21-18(11-26(30)31)14-35-25(21)12-20/h2-10,12,18H,11,13-15H2,1H3,(H,30,31) |
| InChIKey | BEUZWIJEDKTVNU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|