C25H21NO4 — CID 141377350
2-[6-[[3-[2-(3-aminophenyl)ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 141377350) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[6-[[3-[2-(3-aminophenyl)ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[6-[[3-[2-(3-aminophenyl)ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 141377350 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[6-[[3-[2-(3-aminophenyl)ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | Nc1cccc(C#Cc2cccc(COc3ccc4c(c3)OCC4CC(=O)O)c2)c1 |
| InChI | InChI=1S/C25H21NO4/c26-21-6-2-4-18(12-21)8-7-17-3-1-5-19(11-17)15-29-22-9-10-23-20(13-25(27)28)16-30-24(23)14-22/h1-6,9-12,14,20H,13,15-16,26H2,(H,27,28) |
| InChIKey | MKTAVBJNRGSFCC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|