C18H17NO6 — CID 169306834
2-[(3S)-6-[(6-amino-1,3-benzodioxol-4-yl)methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 169306834) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-[(3S)-6-[(6-amino-1,3-benzodioxol-4-yl)methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[(3S)-6-[(6-amino-1,3-benzodioxol-4-yl)methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 169306834 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[(3S)-6-[(6-amino-1,3-benzodioxol-4-yl)methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | Nc1cc(COc2ccc3c(c2)OC[C@H]3CC(=O)O)c2c(c1)OCO2 |
| InChI | InChI=1S/C18H17NO6/c19-12-3-11(18-16(5-12)24-9-25-18)8-22-13-1-2-14-10(4-17(20)21)7-23-15(14)6-13/h1-3,5-6,10H,4,7-9,19H2,(H,20,21)/t10-/m1/s1 |
| InChIKey | HILCHZPNGKETCA-SNVBAGLBSA-N |
| XLogP | 2.53 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|