C19H21NO6 — CID 170016646
2-[(3S)-6-[[5-amino-2-(methoxymethoxy)phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 170016646) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[(3S)-6-[[5-amino-2-(methoxymethoxy)phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[(3S)-6-[[5-amino-2-(methoxymethoxy)phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 170016646 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[(3S)-6-[[5-amino-2-(methoxymethoxy)phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | COCOc1ccc(N)cc1COc1ccc2c(c1)OC[C@H]2CC(=O)O |
| InChI | InChI=1S/C19H21NO6/c1-23-11-26-17-5-2-14(20)6-13(17)10-24-15-3-4-16-12(7-19(21)22)9-25-18(16)8-15/h2-6,8,12H,7,9-11,20H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | PNLZWURNELCZNG-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|