C29H28O7S — CID 141377354
2-[6-[[3-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 141377354) has the molecular formula C29H28O7S and a molecular weight of 520.60 g/mol. Its IUPAC name is 2-[6-[[3-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[6-[[3-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 141377354 |
| Molecular Formula | C29H28O7S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-[6-[[3-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethynyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | CS(=O)(=O)CCCOc1ccc(C#Cc2cccc(COc3ccc4c(c3)OCC4CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C29H28O7S/c1-37(32,33)15-3-14-34-25-10-8-21(9-11-25)6-7-22-4-2-5-23(16-22)19-35-26-12-13-27-24(17-29(30)31)20-36-28(27)18-26/h2,4-5,8-13,16,18,24H,3,14-15,17,19-20H2,1H3,(H,30,31) |
| InChIKey | JZJJIULXNXSXSG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|