C12H17NO4S — CID 63190974
6-(3-methylsulfonylpropoxy)-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 63190974) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 6-(3-methylsulfonylpropoxy)-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 6-(3-methylsulfonylpropoxy)-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 63190974 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 6-(3-methylsulfonylpropoxy)-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CS(=O)(=O)CCCOc1ccc2c(c1)OCC2N |
| InChI | InChI=1S/C12H17NO4S/c1-18(14,15)6-2-5-16-9-3-4-10-11(13)8-17-12(10)7-9/h3-4,7,11H,2,5-6,8,13H2,1H3 |
| InChIKey | CVUWFIRUKOFPIO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|