C31H34O7S — CID 86270641
2-[(3S)-6-[[15-methyl-13-(3-methylsulfonylpropoxy)-6-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 86270641) has the molecular formula C31H34O7S and a molecular weight of 550.67 g/mol. Its IUPAC name is 2-[(3S)-6-[[15-methyl-13-(3-methylsulfonylpropoxy)-6-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[(3S)-6-[[15-methyl-13-(3-methylsulfonylpropoxy)-6-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 86270641 |
| Molecular Formula | C31H34O7S |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 2-[(3S)-6-[[15-methyl-13-(3-methylsulfonylpropoxy)-6-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc2c1-c1cccc(COc3ccc4c(c3)OC[C@H]4CC(=O)O)c1CCC2 |
| InChI | InChI=1S/C31H34O7S/c1-20-14-25(36-12-5-13-39(2,34)35)15-21-6-3-8-26-22(7-4-9-28(26)31(20)21)18-37-24-10-11-27-23(16-30(32)33)19-38-29(27)17-24/h4,7,9-11,14-15,17,23H,3,5-6,8,12-13,16,18-19H2,1-2H3,(H,32,33)/t23-/m1/s1 |
| InChIKey | OGWKGIFSRMGHFB-HSZRJFAPSA-N |
| XLogP | 5.49 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|