C16H15FO5S — CID 141296713
3-[2-fluoro-4-[(5-formyl-4-methoxythiophen-2-yl)methoxy]phenyl]propanoic acid (PubChem CID 141296713) has the molecular formula C16H15FO5S and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-[2-fluoro-4-[(5-formyl-4-methoxythiophen-2-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-4-[(5-formyl-4-methoxythiophen-2-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 141296713 |
| Molecular Formula | C16H15FO5S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 3-[2-fluoro-4-[(5-formyl-4-methoxythiophen-2-yl)methoxy]phenyl]propanoic acid |
| SMILES | COc1cc(COc2ccc(CCC(=O)O)c(F)c2)sc1C=O |
| InChI | InChI=1S/C16H15FO5S/c1-21-14-7-12(23-15(14)8-18)9-22-11-4-2-10(13(17)6-11)3-5-16(19)20/h2,4,6-8H,3,5,9H2,1H3,(H,19,20) |
| InChIKey | VUXYWYLPLHNIBI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|