C34H35NO5 — CID 123934431
ethyl 3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-2-methyl-3-phenylpropanoate (PubChem CID 123934431) has the molecular formula C34H35NO5 and a molecular weight of 537.66 g/mol. Its IUPAC name is ethyl 3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-2-methyl-3-phenylpropanoate.
| Compound Name | ethyl 3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 123934431 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | ethyl 3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]-2-methyl-3-phenylpropanoate |
| SMILES | CCOC(=O)C(C)C(c1ccccc1)c1ccc(OCc2ccc(OC=C(NOC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H35NO5/c1-4-38-34(36)25(2)33(28-13-9-6-10-14-28)29-17-21-31(22-18-29)39-23-26-15-19-30(20-16-26)40-24-32(35-37-3)27-11-7-5-8-12-27/h5-22,24-25,33,35H,4,23H2,1-3H3 |
| InChIKey | HFMXTCZSXNLANB-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|