C23H23NO4 — CID 123713714
[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]methanol (PubChem CID 123713714) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]methanol.
| Compound Name | [4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 123713714 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]methanol |
| SMILES | CONC(=COc1ccc(COc2ccc(CO)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO4/c1-26-24-23(20-5-3-2-4-6-20)17-28-22-13-9-19(10-14-22)16-27-21-11-7-18(15-25)8-12-21/h2-14,17,24-25H,15-16H2,1H3 |
| InChIKey | XBMFXTAHMJHIQB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|