C26H27NO7 — CID 123693725
methyl 2,3-dihydroxy-3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoate (PubChem CID 123693725) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 2,3-dihydroxy-3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 123693725 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | methyl 2,3-dihydroxy-3-[4-[[4-[2-(methoxyamino)-2-phenylethenoxy]phenyl]methoxy]phenyl]propanoate |
| SMILES | CONC(=COc1ccc(COc2ccc(C(O)C(O)C(=O)OC)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO7/c1-31-26(30)25(29)24(28)20-10-14-22(15-11-20)33-16-18-8-12-21(13-9-18)34-17-23(27-32-2)19-6-4-3-5-7-19/h3-15,17,24-25,27-29H,16H2,1-2H3 |
| InChIKey | HFDAXXHOVRGVNI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|