About methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate
methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 142194241) has the molecular formula C18H21IO4
and a molecular weight of 428.27 g/mol. Its IUPAC name is methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate.
Molecular Properties
| Compound Name | methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate |
| PubChem CID | 142194241 |
| Molecular Formula | C18H21IO4 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2ccccc2)cc1.COI |
| InChI | InChI=1S/C17H18O3.CH3IO/c1-19-17(18)12-9-14-7-10-16(11-8-14)20-13-15-5-3-2-4-6-15;1-3-2/h2-8,10-11H,9,12-13H2,1H3;1H3 |
| InChIKey | KIYXBWXQKGQIKT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate?
The IUPAC name of methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate (CID 142194241) is methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate.
What is the SMILES notation for methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate?
The canonical SMILES for methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate is COC(=O)CCc1ccc(OCc2ccccc2)cc1.COI.
What is the InChIKey of methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate?
The InChIKey is KIYXBWXQKGQIKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3.CH3IO/c1-19-17(18)12-9-14-7-10-16(11-8-14)20-13-15-5-3-2-4-6-15;1-3-2/h2-8,10-11H,9,12-13H2,1H3;1H3.
What are the key properties of methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate?
methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate has a molecular weight of 428.27 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hypoiodite;methyl 3-(4-phenylmethoxyphenyl)propanoate is sourced from PubChem (CID 142194241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).