C30H36O7 — CID 67685934
methyl 3-(4-hydroxyphenyl)propanoate;methyl 3-[4-(4-phenoxybutoxy)phenyl]propanoate (PubChem CID 67685934) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is methyl 3-(4-hydroxyphenyl)propanoate;methyl 3-[4-(4-phenoxybutoxy)phenyl]propanoate.
| Compound Name | methyl 3-(4-hydroxyphenyl)propanoate;methyl 3-[4-(4-phenoxybutoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 67685934 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | methyl 3-(4-hydroxyphenyl)propanoate;methyl 3-[4-(4-phenoxybutoxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(O)cc1.COC(=O)CCc1ccc(OCCCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C20H24O4.C10H12O3/c1-22-20(21)14-11-17-9-12-19(13-10-17)24-16-6-5-15-23-18-7-3-2-4-8-18;1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-4,7-10,12-13H,5-6,11,14-16H2,1H3;2-3,5-6,11H,4,7H2,1H3 |
| InChIKey | MELUJPIHODCNJT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|