C29H34O5 — CID 54295592
methyl 3-[4-[3-[4-(1-hydroxy-4-phenylbutyl)phenoxy]propoxy]phenyl]propanoate (PubChem CID 54295592) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is methyl 3-[4-[3-[4-(1-hydroxy-4-phenylbutyl)phenoxy]propoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[3-[4-(1-hydroxy-4-phenylbutyl)phenoxy]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 54295592 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | methyl 3-[4-[3-[4-(1-hydroxy-4-phenylbutyl)phenoxy]propoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCCCOc2ccc(C(O)CCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H34O5/c1-32-29(31)20-13-24-11-16-26(17-12-24)33-21-6-22-34-27-18-14-25(15-19-27)28(30)10-5-9-23-7-3-2-4-8-23/h2-4,7-8,11-12,14-19,28,30H,5-6,9-10,13,20-22H2,1H3 |
| InChIKey | SAOKWTXCKZABCI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|