C33H34O6 — CID 161360857
methyl 3-(4-phenylmethoxyphenyl)propanoate;3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 161360857) has the molecular formula C33H34O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is methyl 3-(4-phenylmethoxyphenyl)propanoate;3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | methyl 3-(4-phenylmethoxyphenyl)propanoate;3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 161360857 |
| Molecular Formula | C33H34O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | methyl 3-(4-phenylmethoxyphenyl)propanoate;3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | COC(=O)CCc1ccc(OCc2ccccc2)cc1.O=C(O)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O3.C16H16O3/c1-19-17(18)12-9-14-7-10-16(11-8-14)20-13-15-5-3-2-4-6-15;17-16(18)11-8-13-6-9-15(10-7-13)19-12-14-4-2-1-3-5-14/h2-8,10-11H,9,12-13H2,1H3;1-7,9-10H,8,11-12H2,(H,17,18) |
| InChIKey | VPDPKLPJGGRJBH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |