C18H21N3O5 — CID 10546372
(3E)-3-amino-3-hydroxyimino-2-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide (PubChem CID 10546372) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (3E)-3-amino-3-hydroxyimino-2-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide.
| Compound Name | (3E)-3-amino-3-hydroxyimino-2-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 10546372 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (3E)-3-amino-3-hydroxyimino-2-phenyl-N-(2,4,6-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(OC)c(NC(=O)C(/C(N)=N\O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C18H21N3O5/c1-24-12-9-13(25-2)16(14(10-12)26-3)20-18(22)15(17(19)21-23)11-7-5-4-6-8-11/h4-10,15,23H,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | OJYHUTLFRXFTRI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|