C13H16N2O2 — CID 62327345
3,4-dimethoxy-N-(1H-pyrrol-2-ylmethyl)aniline (PubChem CID 62327345) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(1H-pyrrol-2-ylmethyl)aniline.
| Compound Name | 3,4-dimethoxy-N-(1H-pyrrol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 62327345 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3,4-dimethoxy-N-(1H-pyrrol-2-ylmethyl)aniline |
| SMILES | COc1ccc(NCc2ccc[nH]2)cc1OC |
| InChI | InChI=1S/C13H16N2O2/c1-16-12-6-5-10(8-13(12)17-2)15-9-11-4-3-7-14-11/h3-8,14-15H,9H2,1-2H3 |
| InChIKey | ZDBOFMFASAXTAH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|