C15H15NO5 — CID 3959315
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3,4-dimethoxybenzoate (PubChem CID 3959315) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3959315 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc[nH]2)cc1OC |
| InChI | InChI=1S/C15H15NO5/c1-19-13-6-5-10(8-14(13)20-2)15(18)21-9-12(17)11-4-3-7-16-11/h3-8,16H,9H2,1-2H3 |
| InChIKey | CSNDIDQTFAKMCC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |