About [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate (PubChem CID 3999225) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate |
| PubChem CID | 3999225 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C14H13NO3/c1-10-4-6-11(7-5-10)14(17)18-9-13(16)12-3-2-8-15-12/h2-8,15H,9H2,1H3 |
| InChIKey | OGJAQANDPMNUMC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate?
The IUPAC name of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate (CID 3999225) is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate.
What is the SMILES notation for [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate?
The canonical SMILES for [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate is Cc1ccc(C(=O)OCC(=O)c2ccc[nH]2)cc1.
What is the InChIKey of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate?
The InChIKey is OGJAQANDPMNUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3/c1-10-4-6-11(7-5-10)14(17)18-9-13(16)12-3-2-8-15-12/h2-8,15H,9H2,1H3.
What are the key properties of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate?
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate has a molecular weight of 243.26 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-methylbenzoate is sourced from PubChem (CID 3999225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).